C29H33F6N3O3SSi — CID 57409390
(3R,5S)-N-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-amine (PubChem CID 57409390) has the molecular formula C29H33F6N3O3SSi and a molecular weight of 645.74 g/mol. Its IUPAC name is (3R,5S)-N-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-amine.
| Compound Name | (3R,5S)-N-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 57409390 |
| Molecular Formula | C29H33F6N3O3SSi |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | (3R,5S)-N-[[3,5-bis(trifluoromethyl)phenyl]sulfamoyl]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-amine |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](NS(=O)(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33F6N3O3SSi/c1-27(2,3)43(25-10-6-4-7-11-25,26-12-8-5-9-13-26)41-19-24-17-23(18-36-24)38-42(39,40)37-22-15-20(28(30,31)32)14-21(16-22)29(33,34)35/h4-16,23-24,36-38H,17-19H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | ZQWJUKWPWBCIAF-RPWUZVMVSA-N |
| XLogP | 5.28 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|