C22H21F6N3O2S — CID 42284500
1-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylpyrazole-4-sulfonamide (PubChem CID 42284500) has the molecular formula C22H21F6N3O2S and a molecular weight of 505.48 g/mol. Its IUPAC name is 1-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylpyrazole-4-sulfonamide.
| Compound Name | 1-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 42284500 |
| Molecular Formula | C22H21F6N3O2S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1-benzyl-N-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylpyrazole-4-sulfonamide |
| SMILES | CC(C)(C)c1nn(Cc2ccccc2)cc1S(=O)(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F6N3O2S/c1-20(2,3)19-18(13-31(29-19)12-14-7-5-4-6-8-14)34(32,33)30-17-10-15(21(23,24)25)9-16(11-17)22(26,27)28/h4-11,13,30H,12H2,1-3H3 |
| InChIKey | HHLLUYNTTQAAAO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |