C29H33F3O2Si — CID 11260512
(E)-6-[tert-butyl(diphenyl)silyl]oxy-2-[3-(trifluoromethyl)phenyl]hex-3-en-2-ol (PubChem CID 11260512) has the molecular formula C29H33F3O2Si and a molecular weight of 498.66 g/mol. Its IUPAC name is (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-[3-(trifluoromethyl)phenyl]hex-3-en-2-ol.
| Compound Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-[3-(trifluoromethyl)phenyl]hex-3-en-2-ol |
|---|---|
| PubChem CID | 11260512 |
| Molecular Formula | C29H33F3O2Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (E)-6-[tert-butyl(diphenyl)silyl]oxy-2-[3-(trifluoromethyl)phenyl]hex-3-en-2-ol |
| SMILES | CC(O)(/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H33F3O2Si/c1-27(2,3)35(25-16-7-5-8-17-25,26-18-9-6-10-19-26)34-21-12-11-20-28(4,33)23-14-13-15-24(22-23)29(30,31)32/h5-11,13-20,22,33H,12,21H2,1-4H3/b20-11+ |
| InChIKey | RHWBNZLUDZSKEL-RGVLZGJSSA-N |
| XLogP | 6.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|