C30H33F6N3O2Si — CID 57409494
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]urea (PubChem CID 57409494) has the molecular formula C30H33F6N3O2Si and a molecular weight of 609.69 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 57409494 |
| Molecular Formula | C30H33F6N3O2Si |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]urea |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](NC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33F6N3O2Si/c1-28(2,3)42(25-10-6-4-7-11-25,26-12-8-5-9-13-26)41-19-24-17-23(18-37-24)39-27(40)38-22-15-20(29(31,32)33)14-21(16-22)30(34,35)36/h4-16,23-24,37H,17-19H2,1-3H3,(H2,38,39,40)/t23-,24+/m1/s1 |
| InChIKey | WYHJQZCCOGOUCZ-RPWUZVMVSA-N |
| XLogP | 6.15 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|