C27H32N6O8 — CID 91936818
ethyl (2R,7S)-2,7-bis[(4-nitrophenyl)carbamoylamino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate (PubChem CID 91936818) has the molecular formula C27H32N6O8 and a molecular weight of 568.59 g/mol. Its IUPAC name is ethyl (2R,7S)-2,7-bis[(4-nitrophenyl)carbamoylamino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | ethyl (2R,7S)-2,7-bis[(4-nitrophenyl)carbamoylamino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 91936818 |
| Molecular Formula | C27H32N6O8 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | ethyl (2R,7S)-2,7-bis[(4-nitrophenyl)carbamoylamino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylate |
| SMILES | CCOC(=O)C12CC[C@@H](NC(=O)Nc3ccc([N+](=O)[O-])cc3)CC1C[C@@H](NC(=O)Nc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C27H32N6O8/c1-2-41-24(34)27-13-11-20(30-25(35)28-18-3-7-22(8-4-18)32(37)38)15-17(27)16-21(12-14-27)31-26(36)29-19-5-9-23(10-6-19)33(39)40/h3-10,17,20-21H,2,11-16H2,1H3,(H2,28,30,35)(H2,29,31,36)/t17?,20-,21+,27? |
| InChIKey | XGYPTVOTMQHXLC-WPEBRZINSA-N |
| XLogP | 4.72 |
| TPSA | 194.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|