C24H34F3N3O4S — CID 134973945
5-acetyloxypentyl 3-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]-5-(trifluoromethyl)benzoate (PubChem CID 134973945) has the molecular formula C24H34F3N3O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is 5-acetyloxypentyl 3-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]-5-(trifluoromethyl)benzoate.
| Compound Name | 5-acetyloxypentyl 3-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 134973945 |
| Molecular Formula | C24H34F3N3O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 5-acetyloxypentyl 3-[[(1R,2R)-2-(dimethylamino)cyclohexyl]carbamothioylamino]-5-(trifluoromethyl)benzoate |
| SMILES | CC(=O)OCCCCCOC(=O)c1cc(NC(=S)N[C@@H]2CCCC[C@H]2N(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H34F3N3O4S/c1-16(31)33-11-7-4-8-12-34-22(32)17-13-18(24(25,26)27)15-19(14-17)28-23(35)29-20-9-5-6-10-21(20)30(2)3/h13-15,20-21H,4-12H2,1-3H3,(H2,28,29,35)/t20-,21-/m1/s1 |
| InChIKey | FSUNBLXQKMACMG-NHCUHLMSSA-N |
| XLogP | 4.75 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|