C18H26F3N3OS — CID 118684831
1-[(1S,2S)-2-[2-hydroxyethyl(methyl)amino]cyclohexyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 118684831) has the molecular formula C18H26F3N3OS and a molecular weight of 389.49 g/mol. Its IUPAC name is 1-[(1S,2S)-2-[2-hydroxyethyl(methyl)amino]cyclohexyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1S,2S)-2-[2-hydroxyethyl(methyl)amino]cyclohexyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 118684831 |
| Molecular Formula | C18H26F3N3OS |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[(1S,2S)-2-[2-hydroxyethyl(methyl)amino]cyclohexyl]-3-[3-methyl-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1cc(NC(=S)N[C@H]2CCCC[C@@H]2N(C)CCO)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H26F3N3OS/c1-12-9-13(18(19,20)21)11-14(10-12)22-17(26)23-15-5-3-4-6-16(15)24(2)7-8-25/h9-11,15-16,25H,3-8H2,1-2H3,(H2,22,23,26)/t15-,16-/m0/s1 |
| InChIKey | JHDRMZNGHUDIAC-HOTGVXAUSA-N |
| XLogP | 3.54 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|