C14H14F6N2OS — CID 2957218
1-[3,5-bis(trifluoromethyl)phenyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 2957218) has the molecular formula C14H14F6N2OS and a molecular weight of 372.33 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2957218 |
| Molecular Formula | C14H14F6N2OS |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1cc(NC(=S)NCC2CCCO2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F6N2OS/c15-13(16,17)8-4-9(14(18,19)20)6-10(5-8)22-12(24)21-7-11-2-1-3-23-11/h4-6,11H,1-3,7H2,(H2,21,22,24) |
| InChIKey | JAFYIBNMLWIHJP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|