C13H11F7N2OS — CID 4767492
1-(oxolan-2-ylmethyl)-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea (PubChem CID 4767492) has the molecular formula C13H11F7N2OS and a molecular weight of 376.30 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 4767492 |
| Molecular Formula | C13H11F7N2OS |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C13H11F7N2OS/c14-7-6(13(18,19)20)8(15)10(17)11(9(7)16)22-12(24)21-4-5-2-1-3-23-5/h5H,1-4H2,(H2,21,22,24) |
| InChIKey | WTSKHGRNQVTMQA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|