C20H34N4OS+2 — CID 5075637
methyl-[1-[(4-methylphenyl)carbamothioyl]piperidin-4-yl]-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 5075637) has the molecular formula C20H34N4OS+2 and a molecular weight of 378.59 g/mol. Its IUPAC name is methyl-[1-[(4-methylphenyl)carbamothioyl]piperidin-4-yl]-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | methyl-[1-[(4-methylphenyl)carbamothioyl]piperidin-4-yl]-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 5075637 |
| Molecular Formula | C20H34N4OS+2 |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | methyl-[1-[(4-methylphenyl)carbamothioyl]piperidin-4-yl]-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | Cc1ccc(NC(=S)N2CCC([NH+](C)CC[NH+]3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C20H32N4OS/c1-17-3-5-18(6-4-17)21-20(26)24-9-7-19(8-10-24)22(2)11-12-23-13-15-25-16-14-23/h3-6,19H,7-16H2,1-2H3,(H,21,26)/p+2 |
| InChIKey | WDYHBSJWOACAKM-UHFFFAOYSA-P |
| XLogP | -0.41 |
| TPSA | 33.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|