C22H35N4O2S+ — CID 4062179
1-(1-acetylpiperidin-4-yl)-3-(2,6-dimethylphenyl)-1-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 4062179) has the molecular formula C22H35N4O2S+ and a molecular weight of 419.62 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(2,6-dimethylphenyl)-1-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(2,6-dimethylphenyl)-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4062179 |
| Molecular Formula | C22H35N4O2S+ |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(2,6-dimethylphenyl)-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CC(=O)N1CCC(N(CC[NH+]2CCOCC2)C(=S)Nc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C22H34N4O2S/c1-17-5-4-6-18(2)21(17)23-22(29)26(12-11-24-13-15-28-16-14-24)20-7-9-25(10-8-20)19(3)27/h4-6,20H,7-16H2,1-3H3,(H,23,29)/p+1 |
| InChIKey | IENCJDZJPPSZBN-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|