C18H29ClN3OS+ — CID 4295972
butyl-[1-[(3-chloro-4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-methylazanium (PubChem CID 4295972) has the molecular formula C18H29ClN3OS+ and a molecular weight of 370.97 g/mol. Its IUPAC name is butyl-[1-[(3-chloro-4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-methylazanium.
| Compound Name | butyl-[1-[(3-chloro-4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
|---|---|
| PubChem CID | 4295972 |
| Molecular Formula | C18H29ClN3OS+ |
| Molecular Weight | 370.97 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | butyl-[1-[(3-chloro-4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-methylazanium |
| SMILES | CCCC[NH+](C)C1CCN(C(=S)Nc2ccc(OC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H28ClN3OS/c1-4-5-10-21(2)15-8-11-22(12-9-15)18(24)20-14-6-7-17(23-3)16(19)13-14/h6-7,13,15H,4-5,8-12H2,1-3H3,(H,20,24)/p+1 |
| InChIKey | DHTDPXYABOTAGJ-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|