C21H32ClN3S — CID 134113688
2-[2-(azepan-1-yl)ethyl]-N-[(4-chlorophenyl)methyl]piperidine-1-carbothioamide (PubChem CID 134113688) has the molecular formula C21H32ClN3S and a molecular weight of 394.03 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethyl]-N-[(4-chlorophenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | 2-[2-(azepan-1-yl)ethyl]-N-[(4-chlorophenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 134113688 |
| Molecular Formula | C21H32ClN3S |
| Molecular Weight | 394.03 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethyl]-N-[(4-chlorophenyl)methyl]piperidine-1-carbothioamide |
| SMILES | S=C(NCc1ccc(Cl)cc1)N1CCCCC1CCN1CCCCCC1 |
| InChI | InChI=1S/C21H32ClN3S/c22-19-10-8-18(9-11-19)17-23-21(26)25-15-6-3-7-20(25)12-16-24-13-4-1-2-5-14-24/h8-11,20H,1-7,12-17H2,(H,23,26) |
| InChIKey | RKCDNTUCQIRXEI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.03 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|