C14H28N4S — CID 51627761
(2R)-N-methyl-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidine-1-carbothioamide (PubChem CID 51627761) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is (2R)-N-methyl-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidine-1-carbothioamide.
| Compound Name | (2R)-N-methyl-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 51627761 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2R)-N-methyl-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidine-1-carbothioamide |
| SMILES | CNC(=S)N1CCCC[C@@H]1CCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H28N4S/c1-15-14(19)18-7-4-3-5-13(18)6-8-17-11-9-16(2)10-12-17/h13H,3-12H2,1-2H3,(H,15,19)/t13-/m1/s1 |
| InChIKey | OTZURXXOWWKYPX-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|