C20H32N4O — CID 125167922
1-[(2R)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-3-pyridin-4-ylpropan-1-one (PubChem CID 125167922) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[(2R)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-3-pyridin-4-ylpropan-1-one.
| Compound Name | 1-[(2R)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-3-pyridin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 125167922 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-[(2R)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-3-pyridin-4-ylpropan-1-one |
| SMILES | CN1CCN(CC[C@H]2CCCCN2C(=O)CCc2ccncc2)CC1 |
| InChI | InChI=1S/C20H32N4O/c1-22-14-16-23(17-15-22)13-9-19-4-2-3-12-24(19)20(25)6-5-18-7-10-21-11-8-18/h7-8,10-11,19H,2-6,9,12-17H2,1H3/t19-/m1/s1 |
| InChIKey | KMKYHSABWYZDHV-LJQANCHMSA-N |
| XLogP | 2.03 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |