C15H27N7O — CID 125158868
1-[(2S)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-2-(tetrazol-2-yl)ethanone (PubChem CID 125158868) has the molecular formula C15H27N7O and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[(2S)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-[(2S)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 125158868 |
| Molecular Formula | C15H27N7O |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[(2S)-2-[2-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]-2-(tetrazol-2-yl)ethanone |
| SMILES | CN1CCN(CC[C@@H]2CCCCN2C(=O)Cn2ncnn2)CC1 |
| InChI | InChI=1S/C15H27N7O/c1-19-8-10-20(11-9-19)7-5-14-4-2-3-6-21(14)15(23)12-22-17-13-16-18-22/h13-14H,2-12H2,1H3/t14-/m0/s1 |
| InChIKey | XAIJEQLKBYHRDD-AWEZNQCLSA-N |
| XLogP | -0.31 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |