C15H27N3O3 — CID 126423639
2-[(2R)-1-[3-(4-methylpiperazin-1-yl)propanoyl]piperidin-2-yl]acetic acid (PubChem CID 126423639) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[(2R)-1-[3-(4-methylpiperazin-1-yl)propanoyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-1-[3-(4-methylpiperazin-1-yl)propanoyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 126423639 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 2-[(2R)-1-[3-(4-methylpiperazin-1-yl)propanoyl]piperidin-2-yl]acetic acid |
| SMILES | CN1CCN(CCC(=O)N2CCCC[C@@H]2CC(=O)O)CC1 |
| InChI | InChI=1S/C15H27N3O3/c1-16-8-10-17(11-9-16)7-5-14(19)18-6-3-2-4-13(18)12-15(20)21/h13H,2-12H2,1H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | ZSYLRTIHKYDZME-CYBMUJFWSA-N |
| XLogP | 0.48 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |