C13H19Cl3N4O3 — CID 66686682
N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;propyl carbamate;hydrochloride (PubChem CID 66686682) has the molecular formula C13H19Cl3N4O3 and a molecular weight of 385.68 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;propyl carbamate;hydrochloride.
| Compound Name | N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;propyl carbamate;hydrochloride |
|---|---|
| PubChem CID | 66686682 |
| Molecular Formula | C13H19Cl3N4O3 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;propyl carbamate;hydrochloride |
| SMILES | CCCOC(N)=O.Cl.NC(N)=NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O.C4H9NO2.ClH/c10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13;1-2-3-7-4(5)6;/h1-3H,4H2,(H4,12,13,14,15);2-3H2,1H3,(H2,5,6);1H |
| InChIKey | PYLWHOTXTHTPJU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|