C12H9Cl2N3 — CID 90975390
(2,6-dichlorophenyl)methyl-pyridin-4-yldiazene (PubChem CID 90975390) has the molecular formula C12H9Cl2N3 and a molecular weight of 266.13 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl-pyridin-4-yldiazene.
| Compound Name | (2,6-dichlorophenyl)methyl-pyridin-4-yldiazene |
|---|---|
| PubChem CID | 90975390 |
| Molecular Formula | C12H9Cl2N3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | (2,6-dichlorophenyl)methyl-pyridin-4-yldiazene |
| SMILES | Clc1cccc(Cl)c1C/N=N/c1ccncc1 |
| InChI | InChI=1S/C12H9Cl2N3/c13-11-2-1-3-12(14)10(11)8-16-17-9-4-6-15-7-5-9/h1-7H,8H2/b17-16+ |
| InChIKey | CWPFOFOGVGFOJF-WUKNDPDISA-N |
| XLogP | 4.67 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|