C12H14Cl2O — CID 43175854
1-(2,6-dichlorophenyl)-4-methylpentan-3-one (PubChem CID 43175854) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-4-methylpentan-3-one.
| Compound Name | 1-(2,6-dichlorophenyl)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 43175854 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2O/c1-8(2)12(15)7-6-9-10(13)4-3-5-11(9)14/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | UAZUXWCLGQNVAE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |