C14H19ClO — CID 91135576
1-(2-chlorophenyl)-4,4-dimethylhexan-3-one (PubChem CID 91135576) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-4,4-dimethylhexan-3-one.
| Compound Name | 1-(2-chlorophenyl)-4,4-dimethylhexan-3-one |
|---|---|
| PubChem CID | 91135576 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(2-chlorophenyl)-4,4-dimethylhexan-3-one |
| SMILES | CCC(C)(C)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C14H19ClO/c1-4-14(2,3)13(16)10-9-11-7-5-6-8-12(11)15/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | UKALMQHUTPUFEZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |