About (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one
(E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one (PubChem CID 56957405) has the molecular formula C17H14Cl2O
and a molecular weight of 305.20 g/mol. Its IUPAC name is (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one.
Molecular Properties
| Compound Name | (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one |
| PubChem CID | 56957405 |
| Molecular Formula | C17H14Cl2O |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2O/c18-15-5-1-3-13(11-15)7-9-17(20)10-8-14-4-2-6-16(19)12-14/h1-7,9,11-12H,8,10H2/b9-7+ |
| InChIKey | YZNANLHUAINEJA-VQHVLOKHSA-N |
| XLogP | 5.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one?
The IUPAC name of (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one (CID 56957405) is (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one.
What is the SMILES notation for (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one?
The canonical SMILES for (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one is O=C(/C=C/c1cccc(Cl)c1)CCc1cccc(Cl)c1.
What is the InChIKey of (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one?
The InChIKey is YZNANLHUAINEJA-VQHVLOKHSA-N. The full InChI is InChI=1S/C17H14Cl2O/c18-15-5-1-3-13(11-15)7-9-17(20)10-8-14-4-2-6-16(19)12-14/h1-7,9,11-12H,8,10H2/b9-7+.
What are the key properties of (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one?
(E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one has a molecular weight of 305.20 g/mol, XLogP of 5.21, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one is sourced from PubChem (CID 56957405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).