C17H14Cl2O — CID 56957405
(E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one (PubChem CID 56957405) has the molecular formula C17H14Cl2O and a molecular weight of 305.20 g/mol. Its IUPAC name is (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one.
| Compound Name | (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one |
|---|---|
| PubChem CID | 56957405 |
| Molecular Formula | C17H14Cl2O |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (E)-1,5-bis(3-chlorophenyl)pent-1-en-3-one |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2O/c18-15-5-1-3-13(11-15)7-9-17(20)10-8-14-4-2-6-16(19)12-14/h1-7,9,11-12H,8,10H2/b9-7+ |
| InChIKey | YZNANLHUAINEJA-VQHVLOKHSA-N |
| XLogP | 5.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|