C28H33NO2 — CID 158007970
(E)-4-[4-[[cyclohexyl-[2-(3H-inden-1-yl)ethyl]amino]methyl]phenyl]-1-hydroxybut-3-en-2-one (PubChem CID 158007970) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (E)-4-[4-[[cyclohexyl-[2-(3H-inden-1-yl)ethyl]amino]methyl]phenyl]-1-hydroxybut-3-en-2-one.
| Compound Name | (E)-4-[4-[[cyclohexyl-[2-(3H-inden-1-yl)ethyl]amino]methyl]phenyl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 158007970 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (E)-4-[4-[[cyclohexyl-[2-(3H-inden-1-yl)ethyl]amino]methyl]phenyl]-1-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(CN(CCC2=CCc3ccccc32)C2CCCCC2)cc1)CO |
| InChI | InChI=1S/C28H33NO2/c30-21-27(31)17-14-22-10-12-23(13-11-22)20-29(26-7-2-1-3-8-26)19-18-25-16-15-24-6-4-5-9-28(24)25/h4-6,9-14,16-17,26,30H,1-3,7-8,15,18-21H2/b17-14+ |
| InChIKey | FENICFMCBZKBQL-SAPNQHFASA-N |
| XLogP | 5.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|