C23H22F3NO2 — CID 162103398
(E)-1-hydroxy-4-[4-[[2-[2-(trifluoromethyl)-3H-inden-1-yl]ethylamino]methyl]phenyl]but-3-en-2-one (PubChem CID 162103398) has the molecular formula C23H22F3NO2 and a molecular weight of 401.43 g/mol. Its IUPAC name is (E)-1-hydroxy-4-[4-[[2-[2-(trifluoromethyl)-3H-inden-1-yl]ethylamino]methyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-1-hydroxy-4-[4-[[2-[2-(trifluoromethyl)-3H-inden-1-yl]ethylamino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 162103398 |
| Molecular Formula | C23H22F3NO2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (E)-1-hydroxy-4-[4-[[2-[2-(trifluoromethyl)-3H-inden-1-yl]ethylamino]methyl]phenyl]but-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(CNCCC2=C(C(F)(F)F)Cc3ccccc32)cc1)CO |
| InChI | InChI=1S/C23H22F3NO2/c24-23(25,26)22-13-18-3-1-2-4-20(18)21(22)11-12-27-14-17-7-5-16(6-8-17)9-10-19(29)15-28/h1-10,27-28H,11-15H2/b10-9+ |
| InChIKey | ZFELPUIRCLMISO-MDZDMXLPSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|