C28H26N2O3 — CID 160936298
N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]pyridine-3-carboxamide (PubChem CID 160936298) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 160936298 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl]-N-[2-(3H-inden-1-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(/C=C/c1ccc(CN(CCC2=CCc3ccccc32)C(=O)c2cccnc2)cc1)CO |
| InChI | InChI=1S/C28H26N2O3/c31-20-26(32)14-11-21-7-9-22(10-8-21)19-30(28(33)25-5-3-16-29-18-25)17-15-24-13-12-23-4-1-2-6-27(23)24/h1-11,13-14,16,18,31H,12,15,17,19-20H2/b14-11+ |
| InChIKey | STXOJKRKLBPWMB-SDNWHVSQSA-N |
| XLogP | 4.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|