C26H30N4O4 — CID 157485412
1-[2-[[3-[2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]ethyl]-1H-indol-5-yl]oxy]ethyl]imidazolidin-2-one (PubChem CID 157485412) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[2-[[3-[2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]ethyl]-1H-indol-5-yl]oxy]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[[3-[2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]ethyl]-1H-indol-5-yl]oxy]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 157485412 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[2-[[3-[2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methylamino]ethyl]-1H-indol-5-yl]oxy]ethyl]imidazolidin-2-one |
| SMILES | O=C(/C=C/c1ccc(CNCCc2c[nH]c3ccc(OCCN4CCNC4=O)cc23)cc1)CO |
| InChI | InChI=1S/C26H30N4O4/c31-18-22(32)6-5-19-1-3-20(4-2-19)16-27-10-9-21-17-29-25-8-7-23(15-24(21)25)34-14-13-30-12-11-28-26(30)33/h1-8,15,17,27,29,31H,9-14,16,18H2,(H,28,33)/b6-5+ |
| InChIKey | BWQROKFGQLVCRZ-AATRIKPKSA-N |
| XLogP | 2.48 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|