C25H32N6O5 — CID 167826131
1,3-bis[2-methyl-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]phenyl]urea (PubChem CID 167826131) has the molecular formula C25H32N6O5 and a molecular weight of 496.57 g/mol. Its IUPAC name is 1,3-bis[2-methyl-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]phenyl]urea.
| Compound Name | 1,3-bis[2-methyl-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 167826131 |
| Molecular Formula | C25H32N6O5 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1,3-bis[2-methyl-4-[2-(2-oxoimidazolidin-1-yl)ethoxy]phenyl]urea |
| SMILES | Cc1cc(OCCN2CCNC2=O)ccc1NC(=O)Nc1ccc(OCCN2CCNC2=O)cc1C |
| InChI | InChI=1S/C25H32N6O5/c1-17-15-19(35-13-11-30-9-7-26-24(30)33)3-5-21(17)28-23(32)29-22-6-4-20(16-18(22)2)36-14-12-31-10-8-27-25(31)34/h3-6,15-16H,7-14H2,1-2H3,(H,26,33)(H,27,34)(H2,28,29,32) |
| InChIKey | ODPRESUATSVZEA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |