C15H23N3O3 — CID 123156882
1-[2-[3-[hydroxy(methyl)amino]-2,4,6-trimethylphenoxy]ethyl]imidazolidin-2-one (PubChem CID 123156882) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[2-[3-[hydroxy(methyl)amino]-2,4,6-trimethylphenoxy]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[3-[hydroxy(methyl)amino]-2,4,6-trimethylphenoxy]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 123156882 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[2-[3-[hydroxy(methyl)amino]-2,4,6-trimethylphenoxy]ethyl]imidazolidin-2-one |
| SMILES | Cc1cc(C)c(N(C)O)c(C)c1OCCN1CCNC1=O |
| InChI | InChI=1S/C15H23N3O3/c1-10-9-11(2)14(12(3)13(10)17(4)20)21-8-7-18-6-5-16-15(18)19/h9,20H,5-8H2,1-4H3,(H,16,19) |
| InChIKey | ZWRXPTOPVCKPPG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|