C29H29N3O5 — CID 161162416
(E)-1-hydroxy-4-[4-[[2-[5-[(4-methyl-3-nitrophenyl)methoxy]-1H-indol-3-yl]ethylamino]methyl]phenyl]but-3-en-2-one (PubChem CID 161162416) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is (E)-1-hydroxy-4-[4-[[2-[5-[(4-methyl-3-nitrophenyl)methoxy]-1H-indol-3-yl]ethylamino]methyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-1-hydroxy-4-[4-[[2-[5-[(4-methyl-3-nitrophenyl)methoxy]-1H-indol-3-yl]ethylamino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 161162416 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (E)-1-hydroxy-4-[4-[[2-[5-[(4-methyl-3-nitrophenyl)methoxy]-1H-indol-3-yl]ethylamino]methyl]phenyl]but-3-en-2-one |
| SMILES | Cc1ccc(COc2ccc3[nH]cc(CCNCc4ccc(/C=C/C(=O)CO)cc4)c3c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H29N3O5/c1-20-2-3-23(14-29(20)32(35)36)19-37-26-10-11-28-27(15-26)24(17-31-28)12-13-30-16-22-6-4-21(5-7-22)8-9-25(34)18-33/h2-11,14-15,17,30-31,33H,12-13,16,18-19H2,1H3/b9-8+ |
| InChIKey | UQBZRVCCYPWEES-CMDGGOBGSA-N |
| XLogP | 4.87 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|