C29H42N4O3 — CID 142124170
N-[(3E)-4-[4-[(but-3-enylamino)methyl]phenyl]buta-1,3-dien-2-yl]hydroxylamine;ethane;1-[2-(3-methylphenoxy)ethyl]imidazolidin-2-one (PubChem CID 142124170) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[(3E)-4-[4-[(but-3-enylamino)methyl]phenyl]buta-1,3-dien-2-yl]hydroxylamine;ethane;1-[2-(3-methylphenoxy)ethyl]imidazolidin-2-one.
| Compound Name | N-[(3E)-4-[4-[(but-3-enylamino)methyl]phenyl]buta-1,3-dien-2-yl]hydroxylamine;ethane;1-[2-(3-methylphenoxy)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 142124170 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | N-[(3E)-4-[4-[(but-3-enylamino)methyl]phenyl]buta-1,3-dien-2-yl]hydroxylamine;ethane;1-[2-(3-methylphenoxy)ethyl]imidazolidin-2-one |
| SMILES | C=CCCNCc1ccc(/C=C/C(=C)NO)cc1.CC.Cc1cccc(OCCN2CCNC2=O)c1 |
| InChI | InChI=1S/C15H20N2O.C12H16N2O2.C2H6/c1-3-4-11-16-12-15-9-7-14(8-10-15)6-5-13(2)17-18;1-10-3-2-4-11(9-10)16-8-7-14-6-5-13-12(14)15;1-2/h3,5-10,16-18H,1-2,4,11-12H2;2-4,9H,5-8H2,1H3,(H,13,15);1-2H3/b6-5+;; |
| InChIKey | LJLPHXJVTTUWSW-TXOOBNKBSA-N |
| XLogP | 5.28 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|