C29H34N2O4 — CID 152921939
2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl-[2-(3H-inden-1-yl)ethyl]amino]ethyl pyrrolidine-1-carboxylate (PubChem CID 152921939) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl-[2-(3H-inden-1-yl)ethyl]amino]ethyl pyrrolidine-1-carboxylate.
| Compound Name | 2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl-[2-(3H-inden-1-yl)ethyl]amino]ethyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 152921939 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-[[4-[(E)-4-hydroxy-3-oxobut-1-enyl]phenyl]methyl-[2-(3H-inden-1-yl)ethyl]amino]ethyl pyrrolidine-1-carboxylate |
| SMILES | O=C(/C=C/c1ccc(CN(CCOC(=O)N2CCCC2)CCC2=CCc3ccccc32)cc1)CO |
| InChI | InChI=1S/C29H34N2O4/c32-22-27(33)14-11-23-7-9-24(10-8-23)21-30(19-20-35-29(34)31-16-3-4-17-31)18-15-26-13-12-25-5-1-2-6-28(25)26/h1-2,5-11,13-14,32H,3-4,12,15-22H2/b14-11+ |
| InChIKey | UJGMIURSYDXPQV-SDNWHVSQSA-N |
| XLogP | 4.33 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|