C21H23BO3 — CID 71613254
(E)-3-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one (PubChem CID 71613254) has the molecular formula C21H23BO3 and a molecular weight of 334.22 g/mol. Its IUPAC name is (E)-3-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71613254 |
| Molecular Formula | C21H23BO3 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (E)-3-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-en-1-one |
| SMILES | CC1(C)OB(c2ccccc2C(=O)/C=C/c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C21H23BO3/c1-20(2)21(3,4)25-22(24-20)18-13-9-8-12-17(18)19(23)15-14-16-10-6-5-7-11-16/h5-15H,1-4H3/b15-14+ |
| InChIKey | XREBLCUYUNKMAK-CCEZHUSRSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|