C24H26BO2P — CID 89375914
diphenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphane (PubChem CID 89375914) has the molecular formula C24H26BO2P and a molecular weight of 388.26 g/mol. Its IUPAC name is diphenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphane.
| Compound Name | diphenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 89375914 |
| Molecular Formula | C24H26BO2P |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | diphenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phosphane |
| SMILES | CC1(C)OB(c2ccccc2P(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H26BO2P/c1-23(2)24(3,4)27-25(26-23)21-17-11-12-18-22(21)28(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-18H,1-4H3 |
| InChIKey | CTDWMZJUAZDTDZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|