C22H38B2O4Si — CID 135057487
1-[2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl-dimethylsilane (PubChem CID 135057487) has the molecular formula C22H38B2O4Si and a molecular weight of 416.25 g/mol. Its IUPAC name is 1-[2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl-dimethylsilane.
| Compound Name | 1-[2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl-dimethylsilane |
|---|---|
| PubChem CID | 135057487 |
| Molecular Formula | C22H38B2O4Si |
| Molecular Weight | 416.25 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-[2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl-dimethylsilane |
| SMILES | CC(c1c(B2OC(C)(C)C(C)(C)O2)cccc1B1OC(C)(C)C(C)(C)O1)[SiH](C)C |
| InChI | InChI=1S/C22H38B2O4Si/c1-15(29(10)11)18-16(23-25-19(2,3)20(4,5)26-23)13-12-14-17(18)24-27-21(6,7)22(8,9)28-24/h12-15,29H,1-11H3 |
| InChIKey | HHAXGXIELSKDII-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|