C40H45BF3NO2Si — CID 172516571
1,1-diphenyl-N-[6,7,8-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]methanimine (PubChem CID 172516571) has the molecular formula C40H45BF3NO2Si and a molecular weight of 667.70 g/mol. Its IUPAC name is 1,1-diphenyl-N-[6,7,8-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]methanimine.
| Compound Name | 1,1-diphenyl-N-[6,7,8-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]methanimine |
|---|---|
| PubChem CID | 172516571 |
| Molecular Formula | C40H45BF3NO2Si |
| Molecular Weight | 667.70 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 1,1-diphenyl-N-[6,7,8-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]methanimine |
| SMILES | CC(C)[Si](C#Cc1c(F)c(F)c(F)c2cc(N=C(c3ccccc3)c3ccccc3)cc(B3OC(C)(C)C(C)(C)O3)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H45BF3NO2Si/c1-25(2)48(26(3)4,27(5)6)22-21-31-34-32(36(43)37(44)35(31)42)23-30(24-33(34)41-46-39(7,8)40(9,10)47-41)45-38(28-17-13-11-14-18-28)29-19-15-12-16-20-29/h11-20,23-27H,1-10H3 |
| InChIKey | MSSBZBSQFRYUSM-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.70 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|