C23H37BFNO2Si — CID 90418659
[7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane (PubChem CID 90418659) has the molecular formula C23H37BFNO2Si and a molecular weight of 417.45 g/mol. Its IUPAC name is [7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane.
| Compound Name | [7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 90418659 |
| Molecular Formula | C23H37BFNO2Si |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | [7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c21 |
| InChI | InChI=1S/C23H37BFNO2Si/c1-15(2)29(16(3)4,17(5)6)26-14-13-18-11-12-19(20(25)21(18)26)24-27-22(7,8)23(9,10)28-24/h11-17H,1-10H3 |
| InChIKey | WHKVMIKJUDLXNI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|