C14H17BFNO2S — CID 163542916
7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (PubChem CID 163542916) has the molecular formula C14H17BFNO2S and a molecular weight of 293.17 g/mol. Its IUPAC name is 7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole.
| Compound Name | 7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 163542916 |
| Molecular Formula | C14H17BFNO2S |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| SMILES | Cc1nc2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c2s1 |
| InChI | InChI=1S/C14H17BFNO2S/c1-8-17-10-7-6-9(11(16)12(10)20-8)15-18-13(2,3)14(4,5)19-15/h6-7H,1-5H3 |
| InChIKey | GZCYSFWEBPYAKL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|