C14H19BN2O2S — CID 123800310
4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 123800310) has the molecular formula C14H19BN2O2S and a molecular weight of 290.20 g/mol. Its IUPAC name is 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 123800310 |
| Molecular Formula | C14H19BN2O2S |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)c2sc(N)nc12 |
| InChI | InChI=1S/C14H19BN2O2S/c1-8-6-7-9(11-10(8)17-12(16)20-11)15-18-13(2,3)14(4,5)19-15/h6-7H,1-5H3,(H2,16,17) |
| InChIKey | NYYSHWJXNICYMD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|