C14H17BFNO4 — CID 155895819
4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one (PubChem CID 155895819) has the molecular formula C14H17BFNO4 and a molecular weight of 293.10 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one.
| Compound Name | 4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 155895819 |
| Molecular Formula | C14H17BFNO4 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 4-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(B3OC(C)(C)C(C)(C)O3)c(F)c21 |
| InChI | InChI=1S/C14H17BFNO4/c1-13(2)14(3,4)21-15(20-13)8-6-7-9-11(10(8)16)17(5)12(18)19-9/h6-7H,1-5H3 |
| InChIKey | RNNWEPIRCIAAAE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|