C17H22BNO4 — CID 140718194
5-cyclopropyl-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one (PubChem CID 140718194) has the molecular formula C17H22BNO4 and a molecular weight of 315.18 g/mol. Its IUPAC name is 5-cyclopropyl-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one.
| Compound Name | 5-cyclopropyl-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 140718194 |
| Molecular Formula | C17H22BNO4 |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-cyclopropyl-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(B3OC(C)(C)C(C)(C)O3)c(C3CC3)cc21 |
| InChI | InChI=1S/C17H22BNO4/c1-16(2)17(3,4)23-18(22-16)12-9-14-13(19(5)15(20)21-14)8-11(12)10-6-7-10/h8-10H,6-7H2,1-5H3 |
| InChIKey | WVBYPZWKMJWORC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|