C16H22BNO5 — CID 139208818
3-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one (PubChem CID 139208818) has the molecular formula C16H22BNO5 and a molecular weight of 319.17 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one.
| Compound Name | 3-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 139208818 |
| Molecular Formula | C16H22BNO5 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-(2-methoxyethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-one |
| SMILES | COCCn1c(=O)oc2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C16H22BNO5/c1-15(2)16(3,4)23-17(22-15)11-6-7-12-13(10-11)21-14(19)18(12)8-9-20-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | WTZUYZLSQVKTHW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|