C15H20BNO5 — CID 140904048
5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(2-methoxyethyl)-1,3-benzoxazol-2-one (PubChem CID 140904048) has the molecular formula C15H20BNO5 and a molecular weight of 305.14 g/mol. Its IUPAC name is 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(2-methoxyethyl)-1,3-benzoxazol-2-one.
| Compound Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(2-methoxyethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 140904048 |
| Molecular Formula | C15H20BNO5 |
| Molecular Weight | 305.14 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3-(2-methoxyethyl)-1,3-benzoxazol-2-one |
| SMILES | COCCn1c(=O)oc2ccc(B3OCC(C)(C)CO3)cc21 |
| InChI | InChI=1S/C15H20BNO5/c1-15(2)9-20-16(21-10-15)11-4-5-13-12(8-11)17(6-7-19-3)14(18)22-13/h4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | XFGAEGHKVBCXAB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|