C10H10INO2 — CID 79787233
6-iodo-3-propyl-1,3-benzoxazol-2-one (PubChem CID 79787233) has the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. Its IUPAC name is 6-iodo-3-propyl-1,3-benzoxazol-2-one.
| Compound Name | 6-iodo-3-propyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79787233 |
| Molecular Formula | C10H10INO2 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 6-iodo-3-propyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(I)ccc21 |
| InChI | InChI=1S/C10H10INO2/c1-2-5-12-8-4-3-7(11)6-9(8)14-10(12)13/h3-4,6H,2,5H2,1H3 |
| InChIKey | MPOPVMGUWMCQAB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|