C13H14ClNO3 — CID 62299172
6-(2-chloropropanoyl)-3-propyl-1,3-benzoxazol-2-one (PubChem CID 62299172) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 6-(2-chloropropanoyl)-3-propyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-chloropropanoyl)-3-propyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62299172 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 6-(2-chloropropanoyl)-3-propyl-1,3-benzoxazol-2-one |
| SMILES | CCCn1c(=O)oc2cc(C(=O)C(C)Cl)ccc21 |
| InChI | InChI=1S/C13H14ClNO3/c1-3-6-15-10-5-4-9(12(16)8(2)14)7-11(10)18-13(15)17/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | OENGYHYUYABAJW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|