C17H23NO4 — CID 82062882
3-nonyl-2-oxo-1,3-benzoxazole-6-carboxylic acid (PubChem CID 82062882) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 3-nonyl-2-oxo-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 3-nonyl-2-oxo-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 82062882 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-nonyl-2-oxo-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CCCCCCCCCn1c(=O)oc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C17H23NO4/c1-2-3-4-5-6-7-8-11-18-14-10-9-13(16(19)20)12-15(14)22-17(18)21/h9-10,12H,2-8,11H2,1H3,(H,19,20) |
| InChIKey | VFDLRSRCIOTEEV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|