C17H23NO3 — CID 82984978
3-ethyl-6-(2-propylpentanoyl)-1,3-benzoxazol-2-one (PubChem CID 82984978) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-ethyl-6-(2-propylpentanoyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-ethyl-6-(2-propylpentanoyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82984978 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-ethyl-6-(2-propylpentanoyl)-1,3-benzoxazol-2-one |
| SMILES | CCCC(CCC)C(=O)c1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C17H23NO3/c1-4-7-12(8-5-2)16(19)13-9-10-14-15(11-13)21-17(20)18(14)6-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | JEXYMOMWCGGGDJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |