C13H15NO4 — CID 116923098
6-[2-(hydroxymethyl)butanoyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116923098) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)butanoyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-(hydroxymethyl)butanoyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116923098 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-[2-(hydroxymethyl)butanoyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | CCC(CO)C(=O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C13H15NO4/c1-3-8(7-15)12(16)9-4-5-10-11(6-9)18-13(17)14(10)2/h4-6,8,15H,3,7H2,1-2H3 |
| InChIKey | NNBFUXJJBSGFOZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |