C11H10N2O5 — CID 116920547
2-amino-3-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-3-oxopropanoic acid (PubChem CID 116920547) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-amino-3-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-3-oxopropanoic acid.
| Compound Name | 2-amino-3-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 116920547 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-amino-3-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-3-oxopropanoic acid |
| SMILES | Cn1c(=O)oc2cc(C(=O)C(N)C(=O)O)ccc21 |
| InChI | InChI=1S/C11H10N2O5/c1-13-6-3-2-5(4-7(6)18-11(13)17)9(14)8(12)10(15)16/h2-4,8H,12H2,1H3,(H,15,16) |
| InChIKey | FWTKRIPNPSNZTH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|