C12H11NO5 — CID 55054066
ethyl 2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-oxoacetate (PubChem CID 55054066) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is ethyl 2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 55054066 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | ethyl 2-(3-methyl-2-oxo-1,3-benzoxazol-6-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1ccc2c(c1)oc(=O)n2C |
| InChI | InChI=1S/C12H11NO5/c1-3-17-11(15)10(14)7-4-5-8-9(6-7)18-12(16)13(8)2/h4-6H,3H2,1-2H3 |
| InChIKey | GKFXCRYSSXQNAQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|