C17H15NO3 — CID 62275171
6-(3,4-dimethylbenzoyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 62275171) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-(3,4-dimethylbenzoyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(3,4-dimethylbenzoyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62275171 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-(3,4-dimethylbenzoyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(C(=O)c2ccc3c(c2)oc(=O)n3C)cc1C |
| InChI | InChI=1S/C17H15NO3/c1-10-4-5-12(8-11(10)2)16(19)13-6-7-14-15(9-13)21-17(20)18(14)3/h4-9H,1-3H3 |
| InChIKey | DSTLSBRCJQWQOU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |